C14H22 — CID 163402506
(Z)-but-2-ene;(3E,5Z)-3,6-dimethylocta-1,3,5,7-tetraene (PubChem CID 163402506) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is (Z)-but-2-ene;(3E,5Z)-3,6-dimethylocta-1,3,5,7-tetraene.
| Compound Name | (Z)-but-2-ene;(3E,5Z)-3,6-dimethylocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 163402506 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (Z)-but-2-ene;(3E,5Z)-3,6-dimethylocta-1,3,5,7-tetraene |
| SMILES | C/C=C\C.C=C/C(C)=C\C=C(/C)C=C |
| InChI | InChI=1S/C10H14.C4H8/c1-5-9(3)7-8-10(4)6-2;1-3-4-2/h5-8H,1-2H2,3-4H3;3-4H,1-2H3/b9-7-,10-8+;4-3- |
| InChIKey | AFELECZRMUSWRB-CAXSGNAGSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|