C11H18 — CID 144724119
methane;(3E,5Z,7Z)-3-methylnona-1,3,5,7-tetraene (PubChem CID 144724119) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is methane;(3E,5Z,7Z)-3-methylnona-1,3,5,7-tetraene.
| Compound Name | methane;(3E,5Z,7Z)-3-methylnona-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 144724119 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | methane;(3E,5Z,7Z)-3-methylnona-1,3,5,7-tetraene |
| SMILES | C.C=C/C(C)=C/C=C\C=C/C |
| InChI | InChI=1S/C10H14.CH4/c1-4-6-7-8-9-10(3)5-2;/h4-9H,2H2,1,3H3;1H4/b6-4-,8-7-,10-9+; |
| InChIKey | WJRSRTIESCZZGO-BVTZBBLDSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|