C10H15N — CID 134195974
(2E,4Z,6E)-N,2-dimethylocta-2,4,6-trien-1-imine (PubChem CID 134195974) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is (2E,4Z,6E)-N,2-dimethylocta-2,4,6-trien-1-imine.
| Compound Name | (2E,4Z,6E)-N,2-dimethylocta-2,4,6-trien-1-imine |
|---|---|
| PubChem CID | 134195974 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (2E,4Z,6E)-N,2-dimethylocta-2,4,6-trien-1-imine |
| SMILES | C/C=C/C=C\C=C(C)\C=N\C |
| InChI | InChI=1S/C10H15N/c1-4-5-6-7-8-10(2)9-11-3/h4-9H,1-3H3/b5-4+,7-6-,10-8+,11-9+ |
| InChIKey | IAMCZUBBDSTAJG-VJXVANELSA-N |
| XLogP | 2.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|