C14H19N — CID 145412761
(1Z,3E,5E,7Z,9Z,11E)-7-methyltrideca-1,3,5,7,9,11-hexaen-1-amine (PubChem CID 145412761) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (1Z,3E,5E,7Z,9Z,11E)-7-methyltrideca-1,3,5,7,9,11-hexaen-1-amine.
| Compound Name | (1Z,3E,5E,7Z,9Z,11E)-7-methyltrideca-1,3,5,7,9,11-hexaen-1-amine |
|---|---|
| PubChem CID | 145412761 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (1Z,3E,5E,7Z,9Z,11E)-7-methyltrideca-1,3,5,7,9,11-hexaen-1-amine |
| SMILES | C/C=C/C=C\C=C(C)/C=C/C=C/C=C\N |
| InChI | InChI=1S/C14H19N/c1-3-4-5-8-11-14(2)12-9-6-7-10-13-15/h3-13H,15H2,1-2H3/b4-3+,7-6+,8-5-,12-9+,13-10-,14-11- |
| InChIKey | DCPPSBGKPXRUHY-IKBIMCPUSA-N |
| XLogP | 3.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|