C12H20 — CID 143014542
ethane;(3Z,5Z,7Z)-5-methylnona-1,3,5,7-tetraene (PubChem CID 143014542) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is ethane;(3Z,5Z,7Z)-5-methylnona-1,3,5,7-tetraene.
| Compound Name | ethane;(3Z,5Z,7Z)-5-methylnona-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 143014542 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | ethane;(3Z,5Z,7Z)-5-methylnona-1,3,5,7-tetraene |
| SMILES | C=C/C=C\C(C)=C/C=C\C.CC |
| InChI | InChI=1S/C10H14.C2H6/c1-4-6-8-10(3)9-7-5-2;1-2/h4-9H,1H2,2-3H3;1-2H3/b7-5-,8-6-,10-9-; |
| InChIKey | SHPRHBYTWSUFQG-JTWPGVSUSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|