C16H20 — CID 142176568
ethene;(3Z,8E,10Z)-8-methyl-5-methylidenedodeca-1,3,8,10-tetraen-6-yne (PubChem CID 142176568) has the molecular formula C16H20 and a molecular weight of 212.34 g/mol. Its IUPAC name is ethene;(3Z,8E,10Z)-8-methyl-5-methylidenedodeca-1,3,8,10-tetraen-6-yne.
| Compound Name | ethene;(3Z,8E,10Z)-8-methyl-5-methylidenedodeca-1,3,8,10-tetraen-6-yne |
|---|---|
| PubChem CID | 142176568 |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | ethene;(3Z,8E,10Z)-8-methyl-5-methylidenedodeca-1,3,8,10-tetraen-6-yne |
| SMILES | C=C.C=C/C=C\C(=C)C#C/C(C)=C/C=C\C |
| InChI | InChI=1S/C14H16.C2H4/c1-5-7-9-13(3)11-12-14(4)10-8-6-2;1-2/h5-10H,1,3H2,2,4H3;1-2H2/b8-6-,9-7-,14-10+; |
| InChIKey | UEAWMUGZFWUOGF-ASRLQXPASA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|