C17H24O — CID 143116902
ethane;(2Z,4E)-8-[(3Z)-hexa-1,3,5-trien-2-yl]oxy-5-methylocta-2,4-dien-6-yne (PubChem CID 143116902) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is ethane;(2Z,4E)-8-[(3Z)-hexa-1,3,5-trien-2-yl]oxy-5-methylocta-2,4-dien-6-yne.
| Compound Name | ethane;(2Z,4E)-8-[(3Z)-hexa-1,3,5-trien-2-yl]oxy-5-methylocta-2,4-dien-6-yne |
|---|---|
| PubChem CID | 143116902 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | ethane;(2Z,4E)-8-[(3Z)-hexa-1,3,5-trien-2-yl]oxy-5-methylocta-2,4-dien-6-yne |
| SMILES | C=C/C=C\C(=C)OCC#C/C(C)=C/C=C\C.CC |
| InChI | InChI=1S/C15H18O.C2H6/c1-5-7-10-14(3)11-9-13-16-15(4)12-8-6-2;1-2/h5-8,10,12H,2,4,13H2,1,3H3;1-2H3/b7-5-,12-8-,14-10+; |
| InChIKey | OIPRJWQEQYMMKL-TUMDKOQNSA-N |
| XLogP | 4.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|