C12H18O — CID 123515731
4-methyl-6-penta-1,3-dien-2-yloxyhexa-1,3-diene (PubChem CID 123515731) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is 4-methyl-6-penta-1,3-dien-2-yloxyhexa-1,3-diene.
| Compound Name | 4-methyl-6-penta-1,3-dien-2-yloxyhexa-1,3-diene |
|---|---|
| PubChem CID | 123515731 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 4-methyl-6-penta-1,3-dien-2-yloxyhexa-1,3-diene |
| SMILES | C=CC=C(C)CCOC(=C)C=CC |
| InChI | InChI=1S/C12H18O/c1-5-7-11(3)9-10-13-12(4)8-6-2/h5-8H,1,4,9-10H2,2-3H3 |
| InChIKey | PFABLAOPMJFWTF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|