C13H22 — CID 143651334
propane;(5Z)-4-[(E)-prop-1-enyl]hepta-1,3,5-triene (PubChem CID 143651334) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is propane;(5Z)-4-[(E)-prop-1-enyl]hepta-1,3,5-triene.
| Compound Name | propane;(5Z)-4-[(E)-prop-1-enyl]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 143651334 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | propane;(5Z)-4-[(E)-prop-1-enyl]hepta-1,3,5-triene |
| SMILES | C=C/C=C(\C=C/C)/C=C/C.CCC |
| InChI | InChI=1S/C10H14.C3H8/c1-4-7-10(8-5-2)9-6-3;1-3-2/h4-9H,1H2,2-3H3;3H2,1-2H3/b8-5-,9-6+,10-7+; |
| InChIKey | OFPXUINLWFKBMA-QBOFHZKPSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|