About [(4E)-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]phosphane
[(4E)-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]phosphane (PubChem CID 166918085) has the molecular formula C11H19P
and a molecular weight of 182.25 g/mol. Its IUPAC name is [(4E)-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]phosphane.
Molecular Properties
| Compound Name | [(4E)-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]phosphane |
| PubChem CID | 166918085 |
| Molecular Formula | C11H19P |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | [(4E)-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]phosphane |
| SMILES | C=C/C=C(\C=C/C)C(C)(P)CC |
| InChI | InChI=1S/C11H19P/c1-5-8-10(9-6-2)11(4,12)7-3/h5-6,8-9H,1,7,12H2,2-4H3/b9-6-,10-8+ |
| InChIKey | HNKCUFJSCMBRJD-NULKZJHKSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(4E)-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4E)-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]phosphane?
The IUPAC name of [(4E)-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]phosphane (CID 166918085) is [(4E)-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]phosphane.
What is the SMILES notation for [(4E)-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]phosphane?
The canonical SMILES for [(4E)-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]phosphane is C=C/C=C(\C=C/C)C(C)(P)CC.
What is the InChIKey of [(4E)-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]phosphane?
The InChIKey is HNKCUFJSCMBRJD-NULKZJHKSA-N. The full InChI is InChI=1S/C11H19P/c1-5-8-10(9-6-2)11(4,12)7-3/h5-6,8-9H,1,7,12H2,2-4H3/b9-6-,10-8+.
What are the key properties of [(4E)-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]phosphane?
[(4E)-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]phosphane has a molecular weight of 182.25 g/mol, XLogP of 3.72, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(4E)-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]phosphane is sourced from PubChem (CID 166918085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).