C15H27N — CID 164862576
ethane;(4E)-3-ethyl-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-imine (PubChem CID 164862576) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is ethane;(4E)-3-ethyl-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-imine.
| Compound Name | ethane;(4E)-3-ethyl-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-imine |
|---|---|
| PubChem CID | 164862576 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | ethane;(4E)-3-ethyl-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-imine |
| SMILES | CC.[H]/N=C/CC(C)(CC)C(/C=C\C)=C/C=C |
| InChI | InChI=1S/C13H21N.C2H6/c1-5-8-12(9-6-2)13(4,7-3)10-11-14;1-2/h5-6,8-9,11,14H,1,7,10H2,2-4H3;1-2H3/b9-6-,12-8+,14-11+; |
| InChIKey | RSQCMALTZJCEAY-JGOBEGDTSA-N |
| XLogP | 5.16 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|