C16H29N — CID 177001360
(5E)-2,2,3,4,4-pentamethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-3-amine (PubChem CID 177001360) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is (5E)-2,2,3,4,4-pentamethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-3-amine.
| Compound Name | (5E)-2,2,3,4,4-pentamethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-3-amine |
|---|---|
| PubChem CID | 177001360 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | (5E)-2,2,3,4,4-pentamethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-3-amine |
| SMILES | C=C/C=C(\C=C/C)C(C)(C)C(C)(N)C(C)(C)C |
| InChI | InChI=1S/C16H29N/c1-9-11-13(12-10-2)15(6,7)16(8,17)14(3,4)5/h9-12H,1,17H2,2-8H3/b12-10-,13-11+ |
| InChIKey | BYUZPAHROLBZLZ-PJABCKPXSA-N |
| XLogP | 4.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|