C12H23N — CID 129252767
(E)-2,5,5-trimethyl-3-[(Z)-prop-1-enyl]hex-3-en-2-amine (PubChem CID 129252767) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (E)-2,5,5-trimethyl-3-[(Z)-prop-1-enyl]hex-3-en-2-amine.
| Compound Name | (E)-2,5,5-trimethyl-3-[(Z)-prop-1-enyl]hex-3-en-2-amine |
|---|---|
| PubChem CID | 129252767 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (E)-2,5,5-trimethyl-3-[(Z)-prop-1-enyl]hex-3-en-2-amine |
| SMILES | C/C=C\C(=C/C(C)(C)C)C(C)(C)N |
| InChI | InChI=1S/C12H23N/c1-7-8-10(12(5,6)13)9-11(2,3)4/h7-9H,13H2,1-6H3/b8-7-,10-9+ |
| InChIKey | DOLWPBOGLUWEPL-UQGDGPGGSA-N |
| XLogP | 3.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|