C14H24O — CID 71424970
5-tert-butyl-7,7-dimethylocta-3,5-dien-2-one (PubChem CID 71424970) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 5-tert-butyl-7,7-dimethylocta-3,5-dien-2-one.
| Compound Name | 5-tert-butyl-7,7-dimethylocta-3,5-dien-2-one |
|---|---|
| PubChem CID | 71424970 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 5-tert-butyl-7,7-dimethylocta-3,5-dien-2-one |
| SMILES | CC(=O)C=CC(=CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H24O/c1-11(15)8-9-12(14(5,6)7)10-13(2,3)4/h8-10H,1-7H3 |
| InChIKey | RHTURXDZLXRGLB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|