About (Z)-4-oxopent-2-enoic acid;(E)-4-oxopent-2-enoic acid
(Z)-4-oxopent-2-enoic acid;(E)-4-oxopent-2-enoic acid (PubChem CID 158960981) has the molecular formula C10H12O6
and a molecular weight of 228.20 g/mol. Its IUPAC name is (Z)-4-oxopent-2-enoic acid;(E)-4-oxopent-2-enoic acid.
Molecular Properties
| Compound Name | (Z)-4-oxopent-2-enoic acid;(E)-4-oxopent-2-enoic acid |
| PubChem CID | 158960981 |
| Molecular Formula | C10H12O6 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | (Z)-4-oxopent-2-enoic acid;(E)-4-oxopent-2-enoic acid |
| SMILES | CC(=O)/C=C/C(=O)O.CC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/2C5H6O3/c2*1-4(6)2-3-5(7)8/h2*2-3H,1H3,(H,7,8)/b3-2+;3-2- |
| InChIKey | JMPSHMPZUMXOIK-HVMWSGSDSA-N |
| XLogP | 0.43 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-oxopent-2-enoic acid;(E)-4-oxopent-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-oxopent-2-enoic acid;(E)-4-oxopent-2-enoic acid?
The IUPAC name of (Z)-4-oxopent-2-enoic acid;(E)-4-oxopent-2-enoic acid (CID 158960981) is (Z)-4-oxopent-2-enoic acid;(E)-4-oxopent-2-enoic acid.
What is the SMILES notation for (Z)-4-oxopent-2-enoic acid;(E)-4-oxopent-2-enoic acid?
The canonical SMILES for (Z)-4-oxopent-2-enoic acid;(E)-4-oxopent-2-enoic acid is CC(=O)/C=C/C(=O)O.CC(=O)/C=C\C(=O)O.
What is the InChIKey of (Z)-4-oxopent-2-enoic acid;(E)-4-oxopent-2-enoic acid?
The InChIKey is JMPSHMPZUMXOIK-HVMWSGSDSA-N. The full InChI is InChI=1S/2C5H6O3/c2*1-4(6)2-3-5(7)8/h2*2-3H,1H3,(H,7,8)/b3-2+;3-2-.
What are the key properties of (Z)-4-oxopent-2-enoic acid;(E)-4-oxopent-2-enoic acid?
(Z)-4-oxopent-2-enoic acid;(E)-4-oxopent-2-enoic acid has a molecular weight of 228.20 g/mol, XLogP of 0.43, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-oxopent-2-enoic acid;(E)-4-oxopent-2-enoic acid is sourced from PubChem (CID 158960981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).