About (Z)-but-2-enedioic acid;silver
(Z)-but-2-enedioic acid;silver (PubChem CID 11002022) has the molecular formula C4H4Ag2O4
and a molecular weight of 331.81 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;silver.
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;silver |
| PubChem CID | 11002022 |
| Molecular Formula | C4H4Ag2O4 |
| Molecular Weight | 331.81 g/mol |
| Exact Mass | 329.82 |
| IUPAC Name | (Z)-but-2-enedioic acid;silver |
| SMILES | O=C(O)/C=C\C(=O)O.[Ag].[Ag] |
| InChI | InChI=1S/C4H4O4.2Ag/c5-3(6)1-2-4(7)8;;/h1-2H,(H,5,6)(H,7,8);;/b2-1-;; |
| InChIKey | YVIWGMHAAZYZGK-UAIGNFCESA-N |
| XLogP | -0.29 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.81 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;silver?
The IUPAC name of (Z)-but-2-enedioic acid;silver (CID 11002022) is (Z)-but-2-enedioic acid;silver.
What is the SMILES notation for (Z)-but-2-enedioic acid;silver?
The canonical SMILES for (Z)-but-2-enedioic acid;silver is O=C(O)/C=C\C(=O)O.[Ag].[Ag].
What is the InChIKey of (Z)-but-2-enedioic acid;silver?
The InChIKey is YVIWGMHAAZYZGK-UAIGNFCESA-N. The full InChI is InChI=1S/C4H4O4.2Ag/c5-3(6)1-2-4(7)8;;/h1-2H,(H,5,6)(H,7,8);;/b2-1-;;.
What are the key properties of (Z)-but-2-enedioic acid;silver?
(Z)-but-2-enedioic acid;silver has a molecular weight of 331.81 g/mol, XLogP of -0.29, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;silver is sourced from PubChem (CID 11002022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).