About (Z)-but-2-enedioic acid;neodymium
(Z)-but-2-enedioic acid;neodymium (PubChem CID 87072249) has the molecular formula C4H4NdO4
and a molecular weight of 260.31 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;neodymium.
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;neodymium |
| PubChem CID | 87072249 |
| Molecular Formula | C4H4NdO4 |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 257.92 |
| IUPAC Name | (Z)-but-2-enedioic acid;neodymium |
| SMILES | O=C(O)/C=C\C(=O)O.[Nd] |
| InChI | InChI=1S/C4H4O4.Nd/c5-3(6)1-2-4(7)8;/h1-2H,(H,5,6)(H,7,8);/b2-1-; |
| InChIKey | OOXZRXLBARUSOD-ODZAUARKSA-N |
| XLogP | -0.29 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;neodymium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;neodymium?
The IUPAC name of (Z)-but-2-enedioic acid;neodymium (CID 87072249) is (Z)-but-2-enedioic acid;neodymium.
What is the SMILES notation for (Z)-but-2-enedioic acid;neodymium?
The canonical SMILES for (Z)-but-2-enedioic acid;neodymium is O=C(O)/C=C\C(=O)O.[Nd].
What is the InChIKey of (Z)-but-2-enedioic acid;neodymium?
The InChIKey is OOXZRXLBARUSOD-ODZAUARKSA-N. The full InChI is InChI=1S/C4H4O4.Nd/c5-3(6)1-2-4(7)8;/h1-2H,(H,5,6)(H,7,8);/b2-1-;.
What are the key properties of (Z)-but-2-enedioic acid;neodymium?
(Z)-but-2-enedioic acid;neodymium has a molecular weight of 260.31 g/mol, XLogP of -0.29, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;neodymium is sourced from PubChem (CID 87072249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).