C21H44 — CID 162279415
2,2,3,5,5-pentamethylhex-3-ene;2,2,5,5-tetramethylhexane (PubChem CID 162279415) has the molecular formula C21H44 and a molecular weight of 296.58 g/mol. Its IUPAC name is 2,2,3,5,5-pentamethylhex-3-ene;2,2,5,5-tetramethylhexane.
| Compound Name | 2,2,3,5,5-pentamethylhex-3-ene;2,2,5,5-tetramethylhexane |
|---|---|
| PubChem CID | 162279415 |
| Molecular Formula | C21H44 |
| Molecular Weight | 296.58 g/mol |
| Exact Mass | 296.34 |
| IUPAC Name | 2,2,3,5,5-pentamethylhex-3-ene;2,2,5,5-tetramethylhexane |
| SMILES | CC(=CC(C)(C)C)C(C)(C)C.CC(C)(C)CCC(C)(C)C |
| InChI | InChI=1S/C11H22.C10H22/c1-9(11(5,6)7)8-10(2,3)4;1-9(2,3)7-8-10(4,5)6/h8H,1-7H3;7-8H2,1-6H3 |
| InChIKey | SAPLDZJCJUYVJK-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.58 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|