C16H34 — CID 161251628
(E)-4,4-dimethylpent-2-ene;methane;2,4,4-trimethylpent-2-ene (PubChem CID 161251628) has the molecular formula C16H34 and a molecular weight of 226.45 g/mol. Its IUPAC name is (E)-4,4-dimethylpent-2-ene;methane;2,4,4-trimethylpent-2-ene.
| Compound Name | (E)-4,4-dimethylpent-2-ene;methane;2,4,4-trimethylpent-2-ene |
|---|---|
| PubChem CID | 161251628 |
| Molecular Formula | C16H34 |
| Molecular Weight | 226.45 g/mol |
| Exact Mass | 226.27 |
| IUPAC Name | (E)-4,4-dimethylpent-2-ene;methane;2,4,4-trimethylpent-2-ene |
| SMILES | C.C/C=C/C(C)(C)C.CC(C)=CC(C)(C)C |
| InChI | InChI=1S/C8H16.C7H14.CH4/c1-7(2)6-8(3,4)5;1-5-6-7(2,3)4;/h6H,1-5H3;5-6H,1-4H3;1H4/b;6-5+; |
| InChIKey | VBIRESSWKUWHEL-AUNBPGBOSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.45 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|