C14H28 — CID 159305896
(E)-4,4-dimethylpent-2-ene (PubChem CID 159305896) has the molecular formula C14H28 and a molecular weight of 196.38 g/mol. Its IUPAC name is (E)-4,4-dimethylpent-2-ene.
| Compound Name | (E)-4,4-dimethylpent-2-ene |
|---|---|
| PubChem CID | 159305896 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | (E)-4,4-dimethylpent-2-ene |
| SMILES | C/C=C/C(C)(C)C.C/C=C/C(C)(C)C |
| InChI | InChI=1S/2C7H14/c2*1-5-6-7(2,3)4/h2*5-6H,1-4H3/b2*6-5+ |
| InChIKey | LBXKAEVXFMBZIL-HBVWGTQWSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|