C22H44 — CID 162279391
ethene;bis(2,2,5,5-tetramethylhex-3-ene) (PubChem CID 162279391) has the molecular formula C22H44 and a molecular weight of 308.59 g/mol. Its IUPAC name is ethene;bis(2,2,5,5-tetramethylhex-3-ene).
| Compound Name | ethene;bis(2,2,5,5-tetramethylhex-3-ene) |
|---|---|
| PubChem CID | 162279391 |
| Molecular Formula | C22H44 |
| Molecular Weight | 308.59 g/mol |
| Exact Mass | 308.34 |
| IUPAC Name | ethene;bis(2,2,5,5-tetramethylhex-3-ene) |
| SMILES | C=C.CC(C)(C)C=CC(C)(C)C.CC(C)(C)C=CC(C)(C)C |
| InChI | InChI=1S/2C10H20.C2H4/c2*1-9(2,3)7-8-10(4,5)6;1-2/h2*7-8H,1-6H3;1-2H2 |
| InChIKey | PZPBPRTVDGRZSG-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.59 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|