About CID 168724040
CID 168724040 (PubChem CID 168724040) has the molecular formula C11H21
and a molecular weight of 153.29 g/mol.
Molecular Properties
| Compound Name | CID 168724040 |
| PubChem CID | 168724040 |
| Molecular Formula | C11H21 |
| Molecular Weight | 153.29 g/mol |
| Exact Mass | 153.16 |
| IUPAC Name | — |
| SMILES | [CH2]C(C)(C)C/C=C/C(C)(C)C |
| InChI | InChI=1S/C11H21/c1-10(2,3)8-7-9-11(4,5)6/h7,9H,1,8H2,2-6H3/b9-7+ |
| InChIKey | KYRBXYPXDSMNJD-VQHVLOKHSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 168724040 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 168724040?
The IUPAC name of CID 168724040 (CID 168724040) is not available.
What is the SMILES notation for CID 168724040?
The canonical SMILES for CID 168724040 is [CH2]C(C)(C)C/C=C/C(C)(C)C.
What is the InChIKey of CID 168724040?
The InChIKey is KYRBXYPXDSMNJD-VQHVLOKHSA-N. The full InChI is InChI=1S/C11H21/c1-10(2,3)8-7-9-11(4,5)6/h7,9H,1,8H2,2-6H3/b9-7+.
What are the key properties of CID 168724040?
CID 168724040 has a molecular weight of 153.29 g/mol, XLogP of 3.84, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 168724040 is sourced from PubChem (CID 168724040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).