C14H26O — CID 59972091
(Z)-5,5,9,9-tetramethyldec-7-enal (PubChem CID 59972091) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is (Z)-5,5,9,9-tetramethyldec-7-enal.
| Compound Name | (Z)-5,5,9,9-tetramethyldec-7-enal |
|---|---|
| PubChem CID | 59972091 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | (Z)-5,5,9,9-tetramethyldec-7-enal |
| SMILES | CC(C)(C)/C=C\CC(C)(C)CCCC=O |
| InChI | InChI=1S/C14H26O/c1-13(2,3)9-8-11-14(4,5)10-6-7-12-15/h8-9,12H,6-7,10-11H2,1-5H3/b9-8- |
| InChIKey | QVOVPHJZGUOLJW-HJWRWDBZSA-N |
| XLogP | 4.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|