C13H24O — CID 134969056
(E,4R)-4-ethyl-4,7,7-trimethyloct-5-enal (PubChem CID 134969056) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is (E,4R)-4-ethyl-4,7,7-trimethyloct-5-enal.
| Compound Name | (E,4R)-4-ethyl-4,7,7-trimethyloct-5-enal |
|---|---|
| PubChem CID | 134969056 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (E,4R)-4-ethyl-4,7,7-trimethyloct-5-enal |
| SMILES | CC[C@@](C)(/C=C/C(C)(C)C)CCC=O |
| InChI | InChI=1S/C13H24O/c1-6-13(5,8-7-11-14)10-9-12(2,3)4/h9-11H,6-8H2,1-5H3/b10-9+/t13-/m1/s1 |
| InChIKey | VYADOHZYGWHKOB-WTNCMQEWSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|