C15H32 — CID 162128993
2,2-dimethylpropane;(Z)-2,2,5,5-tetramethylhex-3-ene (PubChem CID 162128993) has the molecular formula C15H32 and a molecular weight of 212.42 g/mol. Its IUPAC name is 2,2-dimethylpropane;(Z)-2,2,5,5-tetramethylhex-3-ene.
| Compound Name | 2,2-dimethylpropane;(Z)-2,2,5,5-tetramethylhex-3-ene |
|---|---|
| PubChem CID | 162128993 |
| Molecular Formula | C15H32 |
| Molecular Weight | 212.42 g/mol |
| Exact Mass | 212.25 |
| IUPAC Name | 2,2-dimethylpropane;(Z)-2,2,5,5-tetramethylhex-3-ene |
| SMILES | CC(C)(C)/C=C\C(C)(C)C.CC(C)(C)C |
| InChI | InChI=1S/C10H20.C5H12/c1-9(2,3)7-8-10(4,5)6;1-5(2,3)4/h7-8H,1-6H3;1-4H3/b8-7-; |
| InChIKey | ZIKMOMZIURESGN-CFYXSCKTSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.42 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|