C8H11BrF4 — CID 583662
1-bromo-1,1,2,2-tetrafluoro-5,5-dimethylhex-3-ene (PubChem CID 583662) has the molecular formula C8H11BrF4 and a molecular weight of 263.07 g/mol. Its IUPAC name is 1-bromo-1,1,2,2-tetrafluoro-5,5-dimethylhex-3-ene.
| Compound Name | 1-bromo-1,1,2,2-tetrafluoro-5,5-dimethylhex-3-ene |
|---|---|
| PubChem CID | 583662 |
| Molecular Formula | C8H11BrF4 |
| Molecular Weight | 263.07 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 1-bromo-1,1,2,2-tetrafluoro-5,5-dimethylhex-3-ene |
| SMILES | CC(C)(C)C=CC(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C8H11BrF4/c1-6(2,3)4-5-7(10,11)8(9,12)13/h4-5H,1-3H3 |
| InChIKey | KAHHEOKZJLOFTF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.07 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|