C10H13BrF4 — CID 5362812
(7E)-10-bromo-9,9,10,10-tetrafluorodeca-1,7-diene (PubChem CID 5362812) has the molecular formula C10H13BrF4 and a molecular weight of 289.11 g/mol. Its IUPAC name is (7E)-10-bromo-9,9,10,10-tetrafluorodeca-1,7-diene.
| Compound Name | (7E)-10-bromo-9,9,10,10-tetrafluorodeca-1,7-diene |
|---|---|
| PubChem CID | 5362812 |
| Molecular Formula | C10H13BrF4 |
| Molecular Weight | 289.11 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | (7E)-10-bromo-9,9,10,10-tetrafluorodeca-1,7-diene |
| SMILES | C=CCCCC/C=C/C(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C10H13BrF4/c1-2-3-4-5-6-7-8-9(12,13)10(11,14)15/h2,7-8H,1,3-6H2/b8-7+ |
| InChIKey | QEBWUPAOTZARMA-BQYQJAHWSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.11 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|