C22H16F24I2 — CID 161473433
(7E,15E)-1,1,2,2,3,3,4,4,5,5,6,6,17,17,18,18,19,19,20,20,21,21,22,22-tetracosafluoro-1,22-diiododocosa-7,15-diene (PubChem CID 161473433) has the molecular formula C22H16F24I2 and a molecular weight of 990.13 g/mol. Its IUPAC name is (7E,15E)-1,1,2,2,3,3,4,4,5,5,6,6,17,17,18,18,19,19,20,20,21,21,22,22-tetracosafluoro-1,22-diiododocosa-7,15-diene.
| Compound Name | (7E,15E)-1,1,2,2,3,3,4,4,5,5,6,6,17,17,18,18,19,19,20,20,21,21,22,22-tetracosafluoro-1,22-diiododocosa-7,15-diene |
|---|---|
| PubChem CID | 161473433 |
| Molecular Formula | C22H16F24I2 |
| Molecular Weight | 990.13 g/mol |
| Exact Mass | 989.90 |
| IUPAC Name | (7E,15E)-1,1,2,2,3,3,4,4,5,5,6,6,17,17,18,18,19,19,20,20,21,21,22,22-tetracosafluoro-1,22-diiododocosa-7,15-diene |
| SMILES | FC(F)(I)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)/C=C/CCCCCC/C=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
| InChI | InChI=1S/C22H16F24I2/c23-11(24,13(27,28)15(31,32)17(35,36)19(39,40)21(43,44)47)9-7-5-3-1-2-4-6-8-10-12(25,26)14(29,30)16(33,34)18(37,38)20(41,42)22(45,46)48/h7-10H,1-6H2/b9-7+,10-8+ |
| InChIKey | QFFNIIWENMOGGB-FIFLTTCUSA-N |
| XLogP | 12.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 990.13 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|