C12H9F15 — CID 98453175
(E)-6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentadecafluorododec-4-ene (PubChem CID 98453175) has the molecular formula C12H9F15 and a molecular weight of 438.17 g/mol. Its IUPAC name is (E)-6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentadecafluorododec-4-ene.
| Compound Name | (E)-6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentadecafluorododec-4-ene |
|---|---|
| PubChem CID | 98453175 |
| Molecular Formula | C12H9F15 |
| Molecular Weight | 438.17 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | (E)-6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentadecafluorododec-4-ene |
| SMILES | CCC/C=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H9F15/c1-2-3-4-5-6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)27/h4-5H,2-3H2,1H3/b5-4+ |
| InChIKey | DEQOWOWYUXHCKY-SNAWJCMRSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.17 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|