C12H12F12 — CID 10833880
(Z)-7,7,8,8,9,9,10,10,11,11,12,12-dodecafluorododec-5-ene (PubChem CID 10833880) has the molecular formula C12H12F12 and a molecular weight of 384.20 g/mol. Its IUPAC name is (Z)-7,7,8,8,9,9,10,10,11,11,12,12-dodecafluorododec-5-ene.
| Compound Name | (Z)-7,7,8,8,9,9,10,10,11,11,12,12-dodecafluorododec-5-ene |
|---|---|
| PubChem CID | 10833880 |
| Molecular Formula | C12H12F12 |
| Molecular Weight | 384.20 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | (Z)-7,7,8,8,9,9,10,10,11,11,12,12-dodecafluorododec-5-ene |
| SMILES | CCCC/C=C\C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H12F12/c1-2-3-4-5-6-8(15,16)10(19,20)12(23,24)11(21,22)9(17,18)7(13)14/h5-7H,2-4H2,1H3/b6-5- |
| InChIKey | WRKHZIFAFUVOHR-WAYWQWQTSA-N |
| XLogP | 6.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.20 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|