C12H10F16 — CID 163290372
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorododecane (PubChem CID 163290372) has the molecular formula C12H10F16 and a molecular weight of 458.18 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorododecane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorododecane |
|---|---|
| PubChem CID | 163290372 |
| Molecular Formula | C12H10F16 |
| Molecular Weight | 458.18 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorododecane |
| SMILES | CCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H10F16/c1-2-3-4-6(15,16)8(19,20)10(23,24)12(27,28)11(25,26)9(21,22)7(17,18)5(13)14/h5H,2-4H2,1H3 |
| InChIKey | DLIGZVNEHJMSGK-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.18 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|