C10H14F8 — CID 10613179
1,1,2,2,3,3,4,4-octafluorodecane (PubChem CID 10613179) has the molecular formula C10H14F8 and a molecular weight of 286.21 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluorodecane.
| Compound Name | 1,1,2,2,3,3,4,4-octafluorodecane |
|---|---|
| PubChem CID | 10613179 |
| Molecular Formula | C10H14F8 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluorodecane |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H14F8/c1-2-3-4-5-6-8(13,14)10(17,18)9(15,16)7(11)12/h7H,2-6H2,1H3 |
| InChIKey | ULMICCAYAJVPDO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|