C29H54ClF8P — CID 22731151
2,2,3,3,4,4,5,5-octafluoropentyl(trioctyl)phosphanium chloride (PubChem CID 22731151) has the molecular formula C29H54ClF8P and a molecular weight of 621.16 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentyl(trioctyl)phosphanium chloride.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentyl(trioctyl)phosphanium chloride |
|---|---|
| PubChem CID | 22731151 |
| Molecular Formula | C29H54ClF8P |
| Molecular Weight | 621.16 g/mol |
| Exact Mass | 620.35 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl(trioctyl)phosphanium chloride |
| SMILES | CCCCCCCC[P+](CCCCCCCC)(CCCCCCCC)CC(F)(F)C(F)(F)C(F)(F)C(F)F.[Cl-] |
| InChI | InChI=1S/C29H54F8P.ClH/c1-4-7-10-13-16-19-22-38(23-20-17-14-11-8-5-2,24-21-18-15-12-9-6-3)25-27(32,33)29(36,37)28(34,35)26(30)31;/h26H,4-25H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | LSRJROPWJQJYFT-UHFFFAOYSA-M |
| XLogP | 9.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.16 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|