C9H9F9O — CID 139974730
1-ethoxy-4,4,5,5,6,6,7,7,7-nonafluorohept-2-ene (PubChem CID 139974730) has the molecular formula C9H9F9O and a molecular weight of 304.15 g/mol. Its IUPAC name is 1-ethoxy-4,4,5,5,6,6,7,7,7-nonafluorohept-2-ene.
| Compound Name | 1-ethoxy-4,4,5,5,6,6,7,7,7-nonafluorohept-2-ene |
|---|---|
| PubChem CID | 139974730 |
| Molecular Formula | C9H9F9O |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1-ethoxy-4,4,5,5,6,6,7,7,7-nonafluorohept-2-ene |
| SMILES | CCOCC=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F9O/c1-2-19-5-3-4-6(10,11)7(12,13)8(14,15)9(16,17)18/h3-4H,2,5H2,1H3 |
| InChIKey | BTCFRLKVRRIHNG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|