C12H15F9O5 — CID 14632767
(2S,3R,4R)-5-[(E)-4,4,5,5,6,6,7,7,7-nonafluorohept-2-enoxy]pentane-1,2,3,4-tetrol (PubChem CID 14632767) has the molecular formula C12H15F9O5 and a molecular weight of 410.23 g/mol. Its IUPAC name is (2S,3R,4R)-5-[(E)-4,4,5,5,6,6,7,7,7-nonafluorohept-2-enoxy]pentane-1,2,3,4-tetrol.
| Compound Name | (2S,3R,4R)-5-[(E)-4,4,5,5,6,6,7,7,7-nonafluorohept-2-enoxy]pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 14632767 |
| Molecular Formula | C12H15F9O5 |
| Molecular Weight | 410.23 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | (2S,3R,4R)-5-[(E)-4,4,5,5,6,6,7,7,7-nonafluorohept-2-enoxy]pentane-1,2,3,4-tetrol |
| SMILES | OC[C@H](O)[C@@H](O)[C@H](O)COC/C=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H15F9O5/c13-9(14,10(15,16)11(17,18)12(19,20)21)2-1-3-26-5-7(24)8(25)6(23)4-22/h1-2,6-8,22-25H,3-5H2/b2-1+/t6-,7+,8+/m0/s1 |
| InChIKey | XGYBQJZHEADNIN-SXSRJLBYSA-N |
| XLogP | 1.10 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|