C14H11F17O6 — CID 18664169
(2R,3R,4S,5R)-7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptadecafluoro-1,2,3,4,5-pentahydroxytetradecan-6-one (PubChem CID 18664169) has the molecular formula C14H11F17O6 and a molecular weight of 598.20 g/mol. Its IUPAC name is (2R,3R,4S,5R)-7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptadecafluoro-1,2,3,4,5-pentahydroxytetradecan-6-one.
| Compound Name | (2R,3R,4S,5R)-7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptadecafluoro-1,2,3,4,5-pentahydroxytetradecan-6-one |
|---|---|
| PubChem CID | 18664169 |
| Molecular Formula | C14H11F17O6 |
| Molecular Weight | 598.20 g/mol |
| Exact Mass | 598.03 |
| IUPAC Name | (2R,3R,4S,5R)-7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptadecafluoro-1,2,3,4,5-pentahydroxytetradecan-6-one |
| SMILES | O=C([C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H11F17O6/c15-7(16,6(37)5(36)4(35)3(34)2(33)1-32)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)31/h2-5,32-36H,1H2/t2-,3-,4+,5-/m1/s1 |
| InChIKey | NHMIRVMUYQVCQF-SQOUGZDYSA-N |
| XLogP | 2.00 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|