C10H20O6 — CID 89221826
(4R,5S,6R)-4,5,6,7,8-pentahydroxy-2,2-dimethyloctan-3-one (PubChem CID 89221826) has the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. Its IUPAC name is (4R,5S,6R)-4,5,6,7,8-pentahydroxy-2,2-dimethyloctan-3-one.
| Compound Name | (4R,5S,6R)-4,5,6,7,8-pentahydroxy-2,2-dimethyloctan-3-one |
|---|---|
| PubChem CID | 89221826 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (4R,5S,6R)-4,5,6,7,8-pentahydroxy-2,2-dimethyloctan-3-one |
| SMILES | CC(C)(C)C(=O)[C@H](O)[C@@H](O)[C@H](O)C(O)CO |
| InChI | InChI=1S/C10H20O6/c1-10(2,3)9(16)8(15)7(14)6(13)5(12)4-11/h5-8,11-15H,4H2,1-3H3/t5?,6-,7+,8-/m1/s1 |
| InChIKey | ADTNIVQGULVMEB-KTUCCBJNSA-N |
| XLogP | -1.96 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |