C11H22O7 — CID 58201993
(4R,5R,6S,7R,8R)-4,5,6,7,8,9-hexahydroxy-2,2-dimethylnonan-3-one (PubChem CID 58201993) has the molecular formula C11H22O7 and a molecular weight of 266.29 g/mol. Its IUPAC name is (4R,5R,6S,7R,8R)-4,5,6,7,8,9-hexahydroxy-2,2-dimethylnonan-3-one.
| Compound Name | (4R,5R,6S,7R,8R)-4,5,6,7,8,9-hexahydroxy-2,2-dimethylnonan-3-one |
|---|---|
| PubChem CID | 58201993 |
| Molecular Formula | C11H22O7 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (4R,5R,6S,7R,8R)-4,5,6,7,8,9-hexahydroxy-2,2-dimethylnonan-3-one |
| SMILES | CC(C)(C)C(=O)[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H22O7/c1-11(2,3)10(18)9(17)8(16)7(15)6(14)5(13)4-12/h5-9,12-17H,4H2,1-3H3/t5-,6-,7+,8-,9-/m1/s1 |
| InChIKey | DOQUAHSWIMURSH-SYHAXYEDSA-N |
| XLogP | -2.60 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |