C6H11FO6 — CID 87585737
(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl fluoride (PubChem CID 87585737) has the molecular formula C6H11FO6 and a molecular weight of 198.15 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl fluoride.
| Compound Name | (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl fluoride |
|---|---|
| PubChem CID | 87585737 |
| Molecular Formula | C6H11FO6 |
| Molecular Weight | 198.15 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoyl fluoride |
| SMILES | O=C(F)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H11FO6/c7-6(13)5(12)4(11)3(10)2(9)1-8/h2-5,8-12H,1H2/t2-,3+,4+,5-/m1/s1 |
| InChIKey | IJPVCOQVFLNLAP-MGCNEYSASA-N |
| XLogP | -3.08 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.15 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|