C23H22F15NO4 — CID 57031908
2,3-dihydroxypropyl 4-(7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-pentadecafluorotridec-5-enylamino)benzoate (PubChem CID 57031908) has the molecular formula C23H22F15NO4 and a molecular weight of 661.40 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 4-(7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-pentadecafluorotridec-5-enylamino)benzoate.
| Compound Name | 2,3-dihydroxypropyl 4-(7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-pentadecafluorotridec-5-enylamino)benzoate |
|---|---|
| PubChem CID | 57031908 |
| Molecular Formula | C23H22F15NO4 |
| Molecular Weight | 661.40 g/mol |
| Exact Mass | 661.13 |
| IUPAC Name | 2,3-dihydroxypropyl 4-(7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-pentadecafluorotridec-5-enylamino)benzoate |
| SMILES | O=C(OCC(O)CO)c1ccc(NCCCCC=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H22F15NO4/c24-17(25,18(26,27)19(28,29)20(30,31)21(32,33)22(34,35)23(36,37)38)9-3-1-2-4-10-39-14-7-5-13(6-8-14)16(42)43-12-15(41)11-40/h3,5-9,15,39-41H,1-2,4,10-12H2 |
| InChIKey | GIDULTKZYKTKJS-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.40 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|