C23H38N2O5 — CID 21163264
ethyl 11-[4-(2,3-dihydroxypropylcarbamoyl)anilino]undecanoate (PubChem CID 21163264) has the molecular formula C23H38N2O5 and a molecular weight of 422.57 g/mol. Its IUPAC name is ethyl 11-[4-(2,3-dihydroxypropylcarbamoyl)anilino]undecanoate.
| Compound Name | ethyl 11-[4-(2,3-dihydroxypropylcarbamoyl)anilino]undecanoate |
|---|---|
| PubChem CID | 21163264 |
| Molecular Formula | C23H38N2O5 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | ethyl 11-[4-(2,3-dihydroxypropylcarbamoyl)anilino]undecanoate |
| SMILES | CCOC(=O)CCCCCCCCCCNc1ccc(C(=O)NCC(O)CO)cc1 |
| InChI | InChI=1S/C23H38N2O5/c1-2-30-22(28)11-9-7-5-3-4-6-8-10-16-24-20-14-12-19(13-15-20)23(29)25-17-21(27)18-26/h12-15,21,24,26-27H,2-11,16-18H2,1H3,(H,25,29) |
| InChIKey | NYAZWKCZHBQVBP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|