About (1-methylpiperidin-4-yl) 4-[(6-ethoxy-6-oxohexyl)amino]benzoate
(1-methylpiperidin-4-yl) 4-[(6-ethoxy-6-oxohexyl)amino]benzoate (PubChem CID 21163306) has the molecular formula C21H32N2O4
and a molecular weight of 376.50 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) 4-[(6-ethoxy-6-oxohexyl)amino]benzoate.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl) 4-[(6-ethoxy-6-oxohexyl)amino]benzoate |
| PubChem CID | 21163306 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | (1-methylpiperidin-4-yl) 4-[(6-ethoxy-6-oxohexyl)amino]benzoate |
| SMILES | CCOC(=O)CCCCCNc1ccc(C(=O)OC2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C21H32N2O4/c1-3-26-20(24)7-5-4-6-14-22-18-10-8-17(9-11-18)21(25)27-19-12-15-23(2)16-13-19/h8-11,19,22H,3-7,12-16H2,1-2H3 |
| InChIKey | BWVNSIBIGXWKDK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1-methylpiperidin-4-yl) 4-[(6-ethoxy-6-oxohexyl)amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl) 4-[(6-ethoxy-6-oxohexyl)amino]benzoate?
The IUPAC name of (1-methylpiperidin-4-yl) 4-[(6-ethoxy-6-oxohexyl)amino]benzoate (CID 21163306) is (1-methylpiperidin-4-yl) 4-[(6-ethoxy-6-oxohexyl)amino]benzoate.
What is the SMILES notation for (1-methylpiperidin-4-yl) 4-[(6-ethoxy-6-oxohexyl)amino]benzoate?
The canonical SMILES for (1-methylpiperidin-4-yl) 4-[(6-ethoxy-6-oxohexyl)amino]benzoate is CCOC(=O)CCCCCNc1ccc(C(=O)OC2CCN(C)CC2)cc1.
What is the InChIKey of (1-methylpiperidin-4-yl) 4-[(6-ethoxy-6-oxohexyl)amino]benzoate?
The InChIKey is BWVNSIBIGXWKDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32N2O4/c1-3-26-20(24)7-5-4-6-14-22-18-10-8-17(9-11-18)21(25)27-19-12-15-23(2)16-13-19/h8-11,19,22H,3-7,12-16H2,1-2H3.
What are the key properties of (1-methylpiperidin-4-yl) 4-[(6-ethoxy-6-oxohexyl)amino]benzoate?
(1-methylpiperidin-4-yl) 4-[(6-ethoxy-6-oxohexyl)amino]benzoate has a molecular weight of 376.50 g/mol, XLogP of 3.47, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl) 4-[(6-ethoxy-6-oxohexyl)amino]benzoate is sourced from PubChem (CID 21163306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).