C27H38F3NO6 — CID 163432105
3-hydroxy-4-oxo-4-[4-(16,16,16-trifluorohexadec-7-enylamino)benzoyl]oxybutanoic acid (PubChem CID 163432105) has the molecular formula C27H38F3NO6 and a molecular weight of 529.60 g/mol. Its IUPAC name is 3-hydroxy-4-oxo-4-[4-(16,16,16-trifluorohexadec-7-enylamino)benzoyl]oxybutanoic acid.
| Compound Name | 3-hydroxy-4-oxo-4-[4-(16,16,16-trifluorohexadec-7-enylamino)benzoyl]oxybutanoic acid |
|---|---|
| PubChem CID | 163432105 |
| Molecular Formula | C27H38F3NO6 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | 3-hydroxy-4-oxo-4-[4-(16,16,16-trifluorohexadec-7-enylamino)benzoyl]oxybutanoic acid |
| SMILES | O=C(O)CC(O)C(=O)OC(=O)c1ccc(NCCCCCCC=CCCCCCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C27H38F3NO6/c28-27(29,30)18-12-10-8-6-4-2-1-3-5-7-9-11-13-19-31-22-16-14-21(15-17-22)25(35)37-26(36)23(32)20-24(33)34/h1,3,14-17,23,31-32H,2,4-13,18-20H2,(H,33,34) |
| InChIKey | ARJOATNJFZTNIY-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|