C26H36F3NO6 — CID 54510324
1-O-ethyl 3-O-[4-[(10,10,10-trifluoro-9-oxodecyl)amino]benzoyl] 2-tert-butylpropanedioate (PubChem CID 54510324) has the molecular formula C26H36F3NO6 and a molecular weight of 515.57 g/mol. Its IUPAC name is 1-O-ethyl 3-O-[4-[(10,10,10-trifluoro-9-oxodecyl)amino]benzoyl] 2-tert-butylpropanedioate.
| Compound Name | 1-O-ethyl 3-O-[4-[(10,10,10-trifluoro-9-oxodecyl)amino]benzoyl] 2-tert-butylpropanedioate |
|---|---|
| PubChem CID | 54510324 |
| Molecular Formula | C26H36F3NO6 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | 1-O-ethyl 3-O-[4-[(10,10,10-trifluoro-9-oxodecyl)amino]benzoyl] 2-tert-butylpropanedioate |
| SMILES | CCOC(=O)C(C(=O)OC(=O)c1ccc(NCCCCCCCCC(=O)C(F)(F)F)cc1)C(C)(C)C |
| InChI | InChI=1S/C26H36F3NO6/c1-5-35-23(33)21(25(2,3)4)24(34)36-22(32)18-13-15-19(16-14-18)30-17-11-9-7-6-8-10-12-20(31)26(27,28)29/h13-16,21,30H,5-12,17H2,1-4H3 |
| InChIKey | YIQIZNIVPVORCM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|