C30H47NO5 — CID 54024606
1-O-ethyl 3-O-[4-(tetradec-4-enylamino)benzoyl] 2-tert-butylpropanedioate (PubChem CID 54024606) has the molecular formula C30H47NO5 and a molecular weight of 501.71 g/mol. Its IUPAC name is 1-O-ethyl 3-O-[4-(tetradec-4-enylamino)benzoyl] 2-tert-butylpropanedioate.
| Compound Name | 1-O-ethyl 3-O-[4-(tetradec-4-enylamino)benzoyl] 2-tert-butylpropanedioate |
|---|---|
| PubChem CID | 54024606 |
| Molecular Formula | C30H47NO5 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.35 |
| IUPAC Name | 1-O-ethyl 3-O-[4-(tetradec-4-enylamino)benzoyl] 2-tert-butylpropanedioate |
| SMILES | CCCCCCCCCC=CCCCNc1ccc(C(=O)OC(=O)C(C(=O)OCC)C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H47NO5/c1-6-8-9-10-11-12-13-14-15-16-17-18-23-31-25-21-19-24(20-22-25)27(32)36-29(34)26(30(3,4)5)28(33)35-7-2/h15-16,19-22,26,31H,6-14,17-18,23H2,1-5H3 |
| InChIKey | LBHDGDXRZOHBOY-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|