C11H13F9 — CID 176629655
(E)-6,6,7,7,8,8,9,9,9-nonafluoro-2,2-dimethylnon-4-ene (PubChem CID 176629655) has the molecular formula C11H13F9 and a molecular weight of 316.21 g/mol. Its IUPAC name is (E)-6,6,7,7,8,8,9,9,9-nonafluoro-2,2-dimethylnon-4-ene.
| Compound Name | (E)-6,6,7,7,8,8,9,9,9-nonafluoro-2,2-dimethylnon-4-ene |
|---|---|
| PubChem CID | 176629655 |
| Molecular Formula | C11H13F9 |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (E)-6,6,7,7,8,8,9,9,9-nonafluoro-2,2-dimethylnon-4-ene |
| SMILES | CC(C)(C)C/C=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H13F9/c1-7(2,3)5-4-6-8(12,13)9(14,15)10(16,17)11(18,19)20/h4,6H,5H2,1-3H3/b6-4+ |
| InChIKey | SBAUHDFHJCQFHE-GQCTYLIASA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|