C15H28 — CID 176844045
(4Z,7Z)-2,2,10,10-tetramethylundeca-4,7-diene (PubChem CID 176844045) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is (4Z,7Z)-2,2,10,10-tetramethylundeca-4,7-diene.
| Compound Name | (4Z,7Z)-2,2,10,10-tetramethylundeca-4,7-diene |
|---|---|
| PubChem CID | 176844045 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | (4Z,7Z)-2,2,10,10-tetramethylundeca-4,7-diene |
| SMILES | CC(C)(C)C/C=C\C/C=C\CC(C)(C)C |
| InChI | InChI=1S/C15H28/c1-14(2,3)12-10-8-7-9-11-13-15(4,5)6/h8-11H,7,12-13H2,1-6H3/b10-8-,11-9- |
| InChIKey | SZRNXCDFQPEIQV-WGEIWTTOSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|