C18H28O — CID 157186336
1-tert-butyl-4-[(E)-5,5-dimethylhex-2-enoxy]benzene (PubChem CID 157186336) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is 1-tert-butyl-4-[(E)-5,5-dimethylhex-2-enoxy]benzene.
| Compound Name | 1-tert-butyl-4-[(E)-5,5-dimethylhex-2-enoxy]benzene |
|---|---|
| PubChem CID | 157186336 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 1-tert-butyl-4-[(E)-5,5-dimethylhex-2-enoxy]benzene |
| SMILES | CC(C)(C)C/C=C/COc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H28O/c1-17(2,3)13-7-8-14-19-16-11-9-15(10-12-16)18(4,5)6/h7-12H,13-14H2,1-6H3/b8-7+ |
| InChIKey | DEUVQDDIQOXGLM-BQYQJAHWSA-N |
| XLogP | 5.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|