C20H30O — CID 5383734
1-tert-butyl-4-[(2Z)-3,7-dimethylocta-2,6-dienoxy]benzene (PubChem CID 5383734) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is 1-tert-butyl-4-[(2Z)-3,7-dimethylocta-2,6-dienoxy]benzene.
| Compound Name | 1-tert-butyl-4-[(2Z)-3,7-dimethylocta-2,6-dienoxy]benzene |
|---|---|
| PubChem CID | 5383734 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 1-tert-butyl-4-[(2Z)-3,7-dimethylocta-2,6-dienoxy]benzene |
| SMILES | CC(C)=CCC/C(C)=C\COc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H30O/c1-16(2)8-7-9-17(3)14-15-21-19-12-10-18(11-13-19)20(4,5)6/h8,10-14H,7,9,15H2,1-6H3/b17-14- |
| InChIKey | ZXKBKJVUNCINGX-VKAVYKQESA-N |
| XLogP | 6.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|