C22H30O3 — CID 168749356
ethyl (Z)-3-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]-2-methylprop-2-enoate (PubChem CID 168749356) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is ethyl (Z)-3-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]-2-methylprop-2-enoate.
| Compound Name | ethyl (Z)-3-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 168749356 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | ethyl (Z)-3-[4-[(2E)-3,7-dimethylocta-2,6-dienoxy]phenyl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C\c1ccc(OC/C=C(\C)CCC=C(C)C)cc1 |
| InChI | InChI=1S/C22H30O3/c1-6-24-22(23)19(5)16-20-10-12-21(13-11-20)25-15-14-18(4)9-7-8-17(2)3/h8,10-14,16H,6-7,9,15H2,1-5H3/b18-14+,19-16- |
| InChIKey | JQUVZXTWTBTCQR-RVJCWKLDSA-N |
| XLogP | 5.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|